About 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine
4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine (PubChem CID 16729528) has the molecular formula C14H13N5S
and a molecular weight of 283.36 g/mol. Its IUPAC name is 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 16729528 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine |
| SMILES | C=CCSc1ncnc2c1cnn2Cc1ccncc1 |
| InChI | InChI=1S/C14H13N5S/c1-2-7-20-14-12-8-18-19(13(12)16-10-17-14)9-11-3-5-15-6-4-11/h2-6,8,10H,1,7,9H2 |
| InChIKey | ACYGNBNLROJPSJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine (CID 16729528) is 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine is C=CCSc1ncnc2c1cnn2Cc1ccncc1.
What is the InChIKey of 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine?
The InChIKey is ACYGNBNLROJPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5S/c1-2-7-20-14-12-8-18-19(13(12)16-10-17-14)9-11-3-5-15-6-4-11/h2-6,8,10H,1,7,9H2.
What are the key properties of 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine?
4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine has a molecular weight of 283.36 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enylsulfanyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 16729528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).