About 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile
2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile (PubChem CID 16729557) has the molecular formula C7H5N5S
and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile |
| PubChem CID | 16729557 |
| Molecular Formula | C7H5N5S |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile |
| SMILES | N#CCSc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C7H5N5S/c8-1-2-13-7-5-3-11-12-6(5)9-4-10-7/h3-4H,2H2,(H,9,10,11,12) |
| InChIKey | VOEBJLIEYRZBEZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile?
The IUPAC name of 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile (CID 16729557) is 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile.
What is the SMILES notation for 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile?
The canonical SMILES for 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile is N#CCSc1ncnc2[nH]ncc12.
What is the InChIKey of 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile?
The InChIKey is VOEBJLIEYRZBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5S/c8-1-2-13-7-5-3-11-12-6(5)9-4-10-7/h3-4H,2H2,(H,9,10,11,12).
What are the key properties of 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile?
2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile has a molecular weight of 191.22 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanyl)acetonitrile is sourced from PubChem (CID 16729557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).