C11H12F3N3 — CID 167296068
1-(3,5-dimethyl-5,6-dihydroimidazo[1,5-a]pyridin-7-yl)-2,2,2-trifluoroethanimine (PubChem CID 167296068) has the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. Its IUPAC name is 1-(3,5-dimethyl-5,6-dihydroimidazo[1,5-a]pyridin-7-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(3,5-dimethyl-5,6-dihydroimidazo[1,5-a]pyridin-7-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 167296068 |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(3,5-dimethyl-5,6-dihydroimidazo[1,5-a]pyridin-7-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(/C1=Cc2cnc(C)n2C(C)C1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3N3/c1-6-3-8(10(15)11(12,13)14)4-9-5-16-7(2)17(6)9/h4-6,15H,3H2,1-2H3/b15-10- |
| InChIKey | RGBPERXCURRZGV-GDNBJRDFSA-N |
| XLogP | 3.12 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|