C11H12F3N5 — CID 167296101
5,8-dimethyl-10-(2,2,2-trifluoroethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 167296101) has the molecular formula C11H12F3N5 and a molecular weight of 271.25 g/mol. Its IUPAC name is 5,8-dimethyl-10-(2,2,2-trifluoroethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | 5,8-dimethyl-10-(2,2,2-trifluoroethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 167296101 |
| Molecular Formula | C11H12F3N5 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5,8-dimethyl-10-(2,2,2-trifluoroethyl)-3,4,6,9,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | Cc1nnc2n1CC(C)n1c-2cnc1CC(F)(F)F |
| InChI | InChI=1S/C11H12F3N5/c1-6-5-18-7(2)16-17-10(18)8-4-15-9(19(6)8)3-11(12,13)14/h4,6H,3,5H2,1-2H3 |
| InChIKey | IOPUBHWKFOGUEQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |