C11H22N2 — CID 167296625
cis-(1S,2R)-2-(methylideneamino)-N-propylcycloheptan-1-amine (PubChem CID 167296625) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is cis-(1S,2R)-2-(methylideneamino)-N-propylcycloheptan-1-amine.
| Compound Name | cis-(1S,2R)-2-(methylideneamino)-N-propylcycloheptan-1-amine |
|---|---|
| PubChem CID | 167296625 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | cis-(1S,2R)-2-(methylideneamino)-N-propylcycloheptan-1-amine |
| SMILES | C=N[C@@H]1CCCCC[C@@H]1NCCC |
| InChI | InChI=1S/C11H22N2/c1-3-9-13-11-8-6-4-5-7-10(11)12-2/h10-11,13H,2-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | JQJOLYSTIICAOD-MNOVXSKESA-N |
| XLogP | 2.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|