About 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine
1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine (PubChem CID 167296665) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine |
| PubChem CID | 167296665 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine |
| SMILES | C=C/C=C\NCC(C)N |
| InChI | InChI=1S/C7H14N2/c1-3-4-5-9-6-7(2)8/h3-5,7,9H,1,6,8H2,2H3/b5-4- |
| InChIKey | LLVZOKUMABJQFK-PLNGDYQASA-N |
| XLogP | 0.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine?
The IUPAC name of 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine (CID 167296665) is 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine.
What is the SMILES notation for 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine?
The canonical SMILES for 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine is C=C/C=C\NCC(C)N.
What is the InChIKey of 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine?
The InChIKey is LLVZOKUMABJQFK-PLNGDYQASA-N. The full InChI is InChI=1S/C7H14N2/c1-3-4-5-9-6-7(2)8/h3-5,7,9H,1,6,8H2,2H3/b5-4-.
What are the key properties of 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine?
1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine has a molecular weight of 126.20 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(1Z)-buta-1,3-dienyl]propane-1,2-diamine is sourced from PubChem (CID 167296665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).