C13H17F3O8S — CID 167297143
3,3,3-trifluoro-2-[1-(1-hydroxyethyl)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 167297143) has the molecular formula C13H17F3O8S and a molecular weight of 390.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[1-(1-hydroxyethyl)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[1-(1-hydroxyethyl)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 167297143 |
| Molecular Formula | C13H17F3O8S |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3,3,3-trifluoro-2-[1-(1-hydroxyethyl)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | CC(O)C1OC(=O)C2C(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)CCC12 |
| InChI | InChI=1S/C13H17F3O8S/c1-5(17)10-6-2-3-7(9(6)12(19)24-10)11(18)23-8(13(14,15)16)4-25(20,21)22/h5-10,17H,2-4H2,1H3,(H,20,21,22) |
| InChIKey | HCCGSILJNWWFRF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|