C14H16FN3 — CID 167297148
(5S,7S)-2-ethenyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 167297148) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is (5S,7S)-2-ethenyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-ethenyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 167297148 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (5S,7S)-2-ethenyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=Cc1nc2n(n1)[C@H](C1(C)C=CC=CC1)C[C@@H]2F |
| InChI | InChI=1S/C14H16FN3/c1-3-12-16-13-10(15)9-11(18(13)17-12)14(2)7-5-4-6-8-14/h3-7,10-11H,1,8-9H2,2H3/t10-,11-,14?/m0/s1 |
| InChIKey | WBKOUHWSPSTSBY-RFMBEDMFSA-N |
| XLogP | 3.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |