C14H17F2N3 — CID 167297193
7,7-difluoro-2-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-5,6-dihydropyrrolo[1,2-b][1,2,4]triazole (PubChem CID 167297193) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 7,7-difluoro-2-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-5,6-dihydropyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 7,7-difluoro-2-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-5,6-dihydropyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 167297193 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 7,7-difluoro-2-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-5,6-dihydropyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C/C=C\C=C/C(=C\C)C1CC(F)(F)c2nc(C)nn21 |
| InChI | InChI=1S/C14H17F2N3/c1-4-6-7-8-11(5-2)12-9-14(15,16)13-17-10(3)18-19(12)13/h4-8,12H,9H2,1-3H3/b6-4-,8-7-,11-5+ |
| InChIKey | AJFKBNKKMJPJAR-DIMXEIQZSA-N |
| XLogP | 3.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|