C12H15F3O3 — CID 167297225
1,1,1-trifluorobutan-2-yl (4R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 167297225) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 1,1,1-trifluorobutan-2-yl (4R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | 1,1,1-trifluorobutan-2-yl (4R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 167297225 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1,1,1-trifluorobutan-2-yl (4R)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CCC(OC(=O)C1CC2CC1[C@H]1OC21)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O3/c1-2-8(12(13,14)15)17-11(16)7-4-5-3-6(7)10-9(5)18-10/h5-10H,2-4H2,1H3/t5?,6?,7?,8?,9?,10-/m1/s1 |
| InChIKey | LMDDIQMSCUEQJK-XFXATASKSA-N |
| XLogP | 2.29 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|