C16H17F4N3 — CID 167297271
(5S,7S)-2-[difluoro-[(1R,2R)-2-fluorocyclopropyl]methyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 167297271) has the molecular formula C16H17F4N3 and a molecular weight of 327.33 g/mol. Its IUPAC name is (5S,7S)-2-[difluoro-[(1R,2R)-2-fluorocyclopropyl]methyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-[difluoro-[(1R,2R)-2-fluorocyclopropyl]methyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 167297271 |
| Molecular Formula | C16H17F4N3 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (5S,7S)-2-[difluoro-[(1R,2R)-2-fluorocyclopropyl]methyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C[C@H](F)c2nc(C(F)(F)[C@@H]3C[C@H]3F)nn21 |
| InChI | InChI=1S/C16H17F4N3/c1-3-4-5-6-9(2)13-8-12(18)14-21-15(22-23(13)14)16(19,20)10-7-11(10)17/h3-6,10-13H,2,7-8H2,1H3/b4-3-,6-5-/t10-,11-,12+,13+/m1/s1 |
| InChIKey | BJIBUJIIVQJLBN-KPPPPPTRSA-N |
| XLogP | 4.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|