About N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride
N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride (PubChem CID 167297689) has the molecular formula C9H16ClN5
and a molecular weight of 229.72 g/mol. Its IUPAC name is N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride |
| PubChem CID | 167297689 |
| Molecular Formula | C9H16ClN5 |
| Molecular Weight | 229.72 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride |
| SMILES | [H]/N=C/C(=C\N)NCC/C=C\N/C(Cl)=N/C |
| InChI | InChI=1S/C9H16ClN5/c1-13-9(10)15-5-3-2-4-14-8(6-11)7-12/h3,5-7,11,14H,2,4,12H2,1H3,(H,13,15)/b5-3-,8-7+,11-6+ |
| InChIKey | LZNDMMVTRAANCW-GWZUFSFUSA-N |
| XLogP | 0.74 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.72 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride?
The IUPAC name of N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride (CID 167297689) is N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride.
What is the SMILES notation for N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride?
The canonical SMILES for N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride is [H]/N=C/C(=C\N)NCC/C=C\N/C(Cl)=N/C.
What is the InChIKey of N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride?
The InChIKey is LZNDMMVTRAANCW-GWZUFSFUSA-N. The full InChI is InChI=1S/C9H16ClN5/c1-13-9(10)15-5-3-2-4-14-8(6-11)7-12/h3,5-7,11,14H,2,4,12H2,1H3,(H,13,15)/b5-3-,8-7+,11-6+.
What are the key properties of N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride?
N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride has a molecular weight of 229.72 g/mol, XLogP of 0.74, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]but-1-enyl]-N'-methylcarbamimidoyl chloride is sourced from PubChem (CID 167297689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).