C14H27N3O2 — CID 167297710
1-hydroxy-2,2,7,7,8,9,9-heptamethyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 167297710) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-hydroxy-2,2,7,7,8,9,9-heptamethyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-hydroxy-2,2,7,7,8,9,9-heptamethyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 167297710 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-hydroxy-2,2,7,7,8,9,9-heptamethyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)C(=O)NC(C)(C)N2O |
| InChI | InChI=1S/C14H27N3O2/c1-11(2)8-14(9-12(3,4)16(11)7)10(18)15-13(5,6)17(14)19/h19H,8-9H2,1-7H3,(H,15,18) |
| InChIKey | UVULZPOMJOMHEP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |