About 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine
2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine (PubChem CID 167298184) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine |
| PubChem CID | 167298184 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine |
| SMILES | C=CC(C)CCC(C)CCNN(C)C |
| InChI | InChI=1S/C12H26N2/c1-6-11(2)7-8-12(3)9-10-13-14(4)5/h6,11-13H,1,7-10H2,2-5H3 |
| InChIKey | ZVLZNTGSLWLTCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine (CID 167298184) is 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine is C=CC(C)CCC(C)CCNN(C)C.
What is the InChIKey of 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine?
The InChIKey is ZVLZNTGSLWLTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-6-11(2)7-8-12(3)9-10-13-14(4)5/h6,11-13H,1,7-10H2,2-5H3.
What are the key properties of 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine?
2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine has a molecular weight of 198.35 g/mol, XLogP of 2.68, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dimethyloct-7-enyl)-1,1-dimethylhydrazine is sourced from PubChem (CID 167298184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).