C24H31N7O2 — CID 167298735
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pyridin-2-yl-1,3-oxazol-2-yl)prop-1-ene-1,3-diamine (PubChem CID 167298735) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pyridin-2-yl-1,3-oxazol-2-yl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pyridin-2-yl-1,3-oxazol-2-yl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298735 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pyridin-2-yl-1,3-oxazol-2-yl)prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2ncc(-c3ccccn3)o2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C24H31N7O2/c1-16-21(32-17-8-4-3-5-9-17)12-11-19(30-16)23(25)20(31(2)26)14-28-24-29-15-22(33-24)18-10-6-7-13-27-18/h6-7,10-13,15,17H,3-5,8-9,14,25-26H2,1-2H3,(H,28,29)/b23-20- |
| InChIKey | OPBMJFJPKBRZBO-ATJXCDBQSA-N |
| XLogP | 3.70 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|