C49H50N5O7P — CID 16729977
(4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-[bis(phenylmethoxy)phosphorylmethoxy]phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one (PubChem CID 16729977) has the molecular formula C49H50N5O7P and a molecular weight of 851.94 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-[bis(phenylmethoxy)phosphorylmethoxy]phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-[bis(phenylmethoxy)phosphorylmethoxy]phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 16729977 |
| Molecular Formula | C49H50N5O7P |
| Molecular Weight | 851.94 g/mol |
| Exact Mass | 851.34 |
| IUPAC Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-[bis(phenylmethoxy)phosphorylmethoxy]phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(Cc4cccc(OCP(=O)(OCc5ccccc5)OCc5ccccc5)c4)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C49H50N5O7P/c50-48-42-27-40(24-25-43(42)51-52-48)31-54-45(29-36-16-7-2-8-17-36)47(56)46(55)44(28-35-14-5-1-6-15-35)53(49(54)57)30-39-22-13-23-41(26-39)59-34-62(58,60-32-37-18-9-3-10-19-37)61-33-38-20-11-4-12-21-38/h1-27,44-47,55-56H,28-34H2,(H3,50,51,52)/t44-,45-,46+,47+/m1/s1 |
| InChIKey | DMPRKHMAAPDKPV-XEOVLGQKSA-N |
| XLogP | 8.49 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.94 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|