C39H46N5O7P — CID 16729978
(4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-(diethoxyphosphorylmethoxy)phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one (PubChem CID 16729978) has the molecular formula C39H46N5O7P and a molecular weight of 727.80 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-(diethoxyphosphorylmethoxy)phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-(diethoxyphosphorylmethoxy)phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 16729978 |
| Molecular Formula | C39H46N5O7P |
| Molecular Weight | 727.80 g/mol |
| Exact Mass | 727.31 |
| IUPAC Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-3-[[3-(diethoxyphosphorylmethoxy)phenyl]methyl]-5,6-dihydroxy-1,3-diazepan-2-one |
| SMILES | CCOP(=O)(COc1cccc(CN2C(=O)N(Cc3ccc4[nH]nc(N)c4c3)[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)c1)OCC |
| InChI | InChI=1S/C39H46N5O7P/c1-3-50-52(48,51-4-2)26-49-31-17-11-16-29(20-31)24-43-34(22-27-12-7-5-8-13-27)36(45)37(46)35(23-28-14-9-6-10-15-28)44(39(43)47)25-30-18-19-33-32(21-30)38(40)42-41-33/h5-21,34-37,45-46H,3-4,22-26H2,1-2H3,(H3,40,41,42)/t34-,35-,36+,37+/m1/s1 |
| InChIKey | IRLZLNMMHOQTKV-MDOFDWFASA-N |
| XLogP | 6.13 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.80 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|