C35H38N5O7P — CID 16729979
[3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid (PubChem CID 16729979) has the molecular formula C35H38N5O7P and a molecular weight of 671.69 g/mol. Its IUPAC name is [3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid.
| Compound Name | [3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 16729979 |
| Molecular Formula | C35H38N5O7P |
| Molecular Weight | 671.69 g/mol |
| Exact Mass | 671.25 |
| IUPAC Name | [3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(Cc4cccc(OCP(=O)(O)O)c4)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C35H38N5O7P/c36-34-28-17-26(14-15-29(28)37-38-34)21-40-31(19-24-10-5-2-6-11-24)33(42)32(41)30(18-23-8-3-1-4-9-23)39(35(40)43)20-25-12-7-13-27(16-25)47-22-48(44,45)46/h1-17,30-33,41-42H,18-22H2,(H3,36,37,38)(H2,44,45,46)/t30-,31-,32+,33+/m1/s1 |
| InChIKey | PTBPCJFVFDPVNW-FYZVQMPESA-N |
| XLogP | 4.04 |
| TPSA | 185.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.69 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|