C41H42N5O7P — CID 16729981
[3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methyl-phenoxyphosphinic acid (PubChem CID 16729981) has the molecular formula C41H42N5O7P and a molecular weight of 747.79 g/mol. Its IUPAC name is [3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methyl-phenoxyphosphinic acid.
| Compound Name | [3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methyl-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 16729981 |
| Molecular Formula | C41H42N5O7P |
| Molecular Weight | 747.79 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | [3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]phenoxy]methyl-phenoxyphosphinic acid |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(Cc4cccc(OCP(=O)(O)Oc5ccccc5)c4)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C41H42N5O7P/c42-40-34-22-31(19-20-35(34)43-44-40)26-46-37(24-29-13-6-2-7-14-29)39(48)38(47)36(23-28-11-4-1-5-12-28)45(41(46)49)25-30-15-10-18-33(21-30)52-27-54(50,51)53-32-16-8-3-9-17-32/h1-22,36-39,47-48H,23-27H2,(H,50,51)(H3,42,43,44)/t36-,37-,38+,39+/m1/s1 |
| InChIKey | JJEUICPFHZLYNI-AJWAGCPHSA-N |
| XLogP | 6.13 |
| TPSA | 174.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|