C22H24F3N3O3 — CID 167299825
8-[4-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylanilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 167299825) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is 8-[4-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylanilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 8-[4-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylanilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 167299825 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 8-[4-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-2-methylanilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | Cc1cc(N2CCC(O)(C(F)(F)F)CC2)ccc1Nc1ccc2c(c1)OCCC(=O)N2 |
| InChI | InChI=1S/C22H24F3N3O3/c1-14-12-16(28-9-7-21(30,8-10-28)22(23,24)25)3-5-17(14)26-15-2-4-18-19(13-15)31-11-6-20(29)27-18/h2-5,12-13,26,30H,6-11H2,1H3,(H,27,29) |
| InChIKey | RKXHHYXHAZXERU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|