About 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one
7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 167300197) has the molecular formula C19H23N5O3
and a molecular weight of 369.43 g/mol. Its IUPAC name is 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one |
| PubChem CID | 167300197 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1CN(c2ncc(Nc3ccc4c(c3)OCC(=O)N4C)cn2)CC(C)O1 |
| InChI | InChI=1S/C19H23N5O3/c1-12-9-24(10-13(2)27-12)19-20-7-15(8-21-19)22-14-4-5-16-17(6-14)26-11-18(25)23(16)3/h4-8,12-13,22H,9-11H2,1-3H3 |
| InChIKey | RRWQBIADMSEIEV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
The IUPAC name of 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one (CID 167300197) is 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
The canonical SMILES for 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one is CC1CN(c2ncc(Nc3ccc4c(c3)OCC(=O)N4C)cn2)CC(C)O1.
What is the InChIKey of 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
The InChIKey is RRWQBIADMSEIEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O3/c1-12-9-24(10-13(2)27-12)19-20-7-15(8-21-19)22-14-4-5-16-17(6-14)26-11-18(25)23(16)3/h4-8,12-13,22H,9-11H2,1-3H3.
What are the key properties of 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one has a molecular weight of 369.43 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[2-(2,6-dimethylmorpholin-4-yl)pyrimidin-5-yl]amino]-4-methyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 167300197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).