C14H14N2O — CID 167300766
4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2H-2,7-naphthyridin-1-one (PubChem CID 167300766) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2H-2,7-naphthyridin-1-one.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 167300766 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2H-2,7-naphthyridin-1-one |
| SMILES | C/C=C\C(=C/C)c1c[nH]c(=O)c2cnccc12 |
| InChI | InChI=1S/C14H14N2O/c1-3-5-10(4-2)12-9-16-14(17)13-8-15-7-6-11(12)13/h3-9H,1-2H3,(H,16,17)/b5-3-,10-4+ |
| InChIKey | LALFYUDCIQZSTR-FJQHFOHYSA-N |
| XLogP | 2.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|