C12H20FNS — CID 167301374
6-fluoro-7a-(methylsulfanylmethyl)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizine (PubChem CID 167301374) has the molecular formula C12H20FNS and a molecular weight of 229.36 g/mol. Its IUPAC name is 6-fluoro-7a-(methylsulfanylmethyl)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizine.
| Compound Name | 6-fluoro-7a-(methylsulfanylmethyl)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizine |
|---|---|
| PubChem CID | 167301374 |
| Molecular Formula | C12H20FNS |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 6-fluoro-7a-(methylsulfanylmethyl)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizine |
| SMILES | CSCC12CC(F)CN1C1CCCC1C2 |
| InChI | InChI=1S/C12H20FNS/c1-15-8-12-5-9-3-2-4-11(9)14(12)7-10(13)6-12/h9-11H,2-8H2,1H3 |
| InChIKey | BPTRYGYRTHTCJK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |