About (4-propylcyclohexyl) 4-phenylsulfanylbutanoate
(4-propylcyclohexyl) 4-phenylsulfanylbutanoate (PubChem CID 167301623) has the molecular formula C19H28O2S
and a molecular weight of 320.50 g/mol. Its IUPAC name is (4-propylcyclohexyl) 4-phenylsulfanylbutanoate.
Molecular Properties
| Compound Name | (4-propylcyclohexyl) 4-phenylsulfanylbutanoate |
| PubChem CID | 167301623 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (4-propylcyclohexyl) 4-phenylsulfanylbutanoate |
| SMILES | CCCC1CCC(OC(=O)CCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C19H28O2S/c1-2-7-16-11-13-17(14-12-16)21-19(20)10-6-15-22-18-8-4-3-5-9-18/h3-5,8-9,16-17H,2,6-7,10-15H2,1H3 |
| InChIKey | PXDFEYMGOHHAIR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-propylcyclohexyl) 4-phenylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylcyclohexyl) 4-phenylsulfanylbutanoate?
The IUPAC name of (4-propylcyclohexyl) 4-phenylsulfanylbutanoate (CID 167301623) is (4-propylcyclohexyl) 4-phenylsulfanylbutanoate.
What is the SMILES notation for (4-propylcyclohexyl) 4-phenylsulfanylbutanoate?
The canonical SMILES for (4-propylcyclohexyl) 4-phenylsulfanylbutanoate is CCCC1CCC(OC(=O)CCCSc2ccccc2)CC1.
What is the InChIKey of (4-propylcyclohexyl) 4-phenylsulfanylbutanoate?
The InChIKey is PXDFEYMGOHHAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O2S/c1-2-7-16-11-13-17(14-12-16)21-19(20)10-6-15-22-18-8-4-3-5-9-18/h3-5,8-9,16-17H,2,6-7,10-15H2,1H3.
What are the key properties of (4-propylcyclohexyl) 4-phenylsulfanylbutanoate?
(4-propylcyclohexyl) 4-phenylsulfanylbutanoate has a molecular weight of 320.50 g/mol, XLogP of 5.46, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylcyclohexyl) 4-phenylsulfanylbutanoate is sourced from PubChem (CID 167301623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).