C25H37N5 — CID 16730266
7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-6-amine (PubChem CID 16730266) has the molecular formula C25H37N5 and a molecular weight of 407.61 g/mol. Its IUPAC name is 7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-6-amine.
| Compound Name | 7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-6-amine |
|---|---|
| PubChem CID | 16730266 |
| Molecular Formula | C25H37N5 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-6-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cn1cnc2ncnc(N)c21 |
| InChI | InChI=1S/C25H37N5/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)15-16-30-18-29-25-23(30)24(26)27-17-28-25/h9,11,13,15,17-18H,6-8,10,12,14,16H2,1-5H3,(H2,26,27,28)/b20-11+,21-13+,22-15+ |
| InChIKey | ARJRLRARWXKVPD-FLPKSHQQSA-N |
| XLogP | 6.55 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|