C17H16Cl2O3 — CID 16730269
(2R,3S,5R)-2,3-bis(4-chlorophenyl)-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 16730269) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is (2R,3S,5R)-2,3-bis(4-chlorophenyl)-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2,3-bis(4-chlorophenyl)-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 16730269 |
| Molecular Formula | C17H16Cl2O3 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (2R,3S,5R)-2,3-bis(4-chlorophenyl)-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1C[C@](O)(c2ccc(Cl)cc2)[C@@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H16Cl2O3/c18-13-5-1-11(2-6-13)16-17(21,9-15(10-20)22-16)12-3-7-14(19)8-4-12/h1-8,15-16,20-21H,9-10H2/t15-,16-,17+/m1/s1 |
| InChIKey | XXJIUIJJTWMURB-ZACQAIPSSA-N |
| XLogP | 3.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |