C24H15ClFN5O2 — CID 167302717
N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-5-ethynyl-4-(4-fluoro-2-formylphenyl)-2-methylbenzamide (PubChem CID 167302717) has the molecular formula C24H15ClFN5O2 and a molecular weight of 459.87 g/mol. Its IUPAC name is N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-5-ethynyl-4-(4-fluoro-2-formylphenyl)-2-methylbenzamide.
| Compound Name | N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-5-ethynyl-4-(4-fluoro-2-formylphenyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 167302717 |
| Molecular Formula | C24H15ClFN5O2 |
| Molecular Weight | 459.87 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-5-ethynyl-4-(4-fluoro-2-formylphenyl)-2-methylbenzamide |
| SMILES | C#Cc1cc(C(=O)Nc2cnc(-n3nccn3)c(Cl)c2)c(C)cc1-c1ccc(F)cc1C=O |
| InChI | InChI=1S/C24H15ClFN5O2/c1-3-15-10-20(14(2)8-21(15)19-5-4-17(26)9-16(19)13-32)24(33)30-18-11-22(25)23(27-12-18)31-28-6-7-29-31/h1,4-13H,2H3,(H,30,33) |
| InChIKey | OIAMHAKBVATCJL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|