C15H21Cl — CID 167302723
1-chloro-4-cyclopropyl-2,5-di(propan-2-yl)benzene (PubChem CID 167302723) has the molecular formula C15H21Cl and a molecular weight of 236.79 g/mol. Its IUPAC name is 1-chloro-4-cyclopropyl-2,5-di(propan-2-yl)benzene.
| Compound Name | 1-chloro-4-cyclopropyl-2,5-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 167302723 |
| Molecular Formula | C15H21Cl |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-chloro-4-cyclopropyl-2,5-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C2CC2)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C15H21Cl/c1-9(2)12-8-15(16)13(10(3)4)7-14(12)11-5-6-11/h7-11H,5-6H2,1-4H3 |
| InChIKey | YBJLYUNUWDJHAK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |