C25H29N5O4 — CID 167303197
3-[3-oxo-6-[(1R,2R)-2-(3-pyrazol-1-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167303197) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1R,2R)-2-(3-pyrazol-1-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1R,2R)-2-(3-pyrazol-1-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167303197 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-[3-oxo-6-[(1R,2R)-2-(3-pyrazol-1-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@H]4N4CC(n5cccn5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H29N5O4/c31-23-9-8-21(24(32)27-23)29-13-16-12-18(6-7-19(16)25(29)33)34-22-5-2-1-4-20(22)28-14-17(15-28)30-11-3-10-26-30/h3,6-7,10-12,17,20-22H,1-2,4-5,8-9,13-15H2,(H,27,31,32)/t20-,21?,22-/m1/s1 |
| InChIKey | MDDYVRJEWXULGG-NHXNGRAPSA-N |
| XLogP | 1.89 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|