C20H11F23 — CID 167303395
1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-(2,3,3,4,5,5,6,6,7,7,7-undecafluoroheptan-2-yl)benzene (PubChem CID 167303395) has the molecular formula C20H11F23 and a molecular weight of 688.26 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-(2,3,3,4,5,5,6,6,7,7,7-undecafluoroheptan-2-yl)benzene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-(2,3,3,4,5,5,6,6,7,7,7-undecafluoroheptan-2-yl)benzene |
|---|---|
| PubChem CID | 167303395 |
| Molecular Formula | C20H11F23 |
| Molecular Weight | 688.26 g/mol |
| Exact Mass | 688.05 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-(2,3,3,4,5,5,6,6,7,7,7-undecafluoroheptan-2-yl)benzene |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(C(C)(F)C(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H11F23/c1-10(22,13(27,28)9(21)14(29,30)17(35,36)20(41,42)43)7-3-5-8(6-4-7)12(25,26)16(33,34)19(39,40)18(37,38)15(31,32)11(2,23)24/h3-6,9H,1-2H3 |
| InChIKey | KYULLOAKXDLMAX-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.26 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|