C31H25F3N4O2 — CID 16730353
2-[9-(2-hydroxy-2-methylpropyl)-6-(4,4,4-trifluorobutoxy)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 16730353) has the molecular formula C31H25F3N4O2 and a molecular weight of 542.56 g/mol. Its IUPAC name is 2-[9-(2-hydroxy-2-methylpropyl)-6-(4,4,4-trifluorobutoxy)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[9-(2-hydroxy-2-methylpropyl)-6-(4,4,4-trifluorobutoxy)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 16730353 |
| Molecular Formula | C31H25F3N4O2 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-[9-(2-hydroxy-2-methylpropyl)-6-(4,4,4-trifluorobutoxy)-1H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | CC(C)(O)Cc1ccc2c(c1)c1cc(OCCCC(F)(F)F)ccc1c1nc(-c3c(C#N)cccc3C#N)[nH]c21 |
| InChI | InChI=1S/C31H25F3N4O2/c1-30(2,39)15-18-7-9-22-24(13-18)25-14-21(40-12-4-11-31(32,33)34)8-10-23(25)28-27(22)37-29(38-28)26-19(16-35)5-3-6-20(26)17-36/h3,5-10,13-14,39H,4,11-12,15H2,1-2H3,(H,37,38) |
| InChIKey | OGFOTZYMNNEYTA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|