C24H7F35O — CID 167303617
1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene (PubChem CID 167303617) has the molecular formula C24H7F35O and a molecular weight of 976.25 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene |
|---|---|
| PubChem CID | 167303617 |
| Molecular Formula | C24H7F35O |
| Molecular Weight | 976.25 g/mol |
| Exact Mass | 975.99 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptyl)-4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]benzene |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H7F35O/c1-8(25,26)11(31,32)14(37,38)15(39,40)12(33,34)9(27,28)6-2-4-7(5-3-6)10(29,30)13(35,36)16(41,42)17(43,44)18(45,46)19(47,48)20(49,50)24(58,59)60-21(51,22(52,53)54)23(55,56)57/h2-5H,1H3 |
| InChIKey | JOCWPETUTOMXGV-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.25 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|