C41H51FN2 — CID 167303661
(2E)-1-N-[3-[4-[2-(3,3-dimethyl-2-methylidenebutyl)-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenyl]propyl]-4-N,4-N-dimethylpenta-2,4-diene-1,4-diamine (PubChem CID 167303661) has the molecular formula C41H51FN2 and a molecular weight of 590.87 g/mol. Its IUPAC name is (2E)-1-N-[3-[4-[2-(3,3-dimethyl-2-methylidenebutyl)-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenyl]propyl]-4-N,4-N-dimethylpenta-2,4-diene-1,4-diamine.
| Compound Name | (2E)-1-N-[3-[4-[2-(3,3-dimethyl-2-methylidenebutyl)-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenyl]propyl]-4-N,4-N-dimethylpenta-2,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 167303661 |
| Molecular Formula | C41H51FN2 |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | (2E)-1-N-[3-[4-[2-(3,3-dimethyl-2-methylidenebutyl)-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenyl]propyl]-4-N,4-N-dimethylpenta-2,4-diene-1,4-diamine |
| SMILES | C=C(/C=C/CNCCCc1ccc(C2=C(c3ccc(C)cc3F)CCCc3cc(CC(=C)C(C)(C)C)ccc32)cc1)N(C)C |
| InChI | InChI=1S/C41H51FN2/c1-29-16-22-37(39(42)26-29)38-15-9-14-35-28-33(27-30(2)41(4,5)6)19-23-36(35)40(38)34-20-17-32(18-21-34)13-11-25-43-24-10-12-31(3)44(7)8/h10,12,16-23,26,28,43H,2-3,9,11,13-15,24-25,27H2,1,4-8H3/b12-10+ |
| InChIKey | ZQROXSAFZUODJJ-ZRDIBKRKSA-N |
| XLogP | 9.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|