C32H41F — CID 167303708
4-tert-butyl-8-[2-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-methylpropyl]-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 167303708) has the molecular formula C32H41F and a molecular weight of 444.68 g/mol. Its IUPAC name is 4-tert-butyl-8-[2-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-methylpropyl]-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 4-tert-butyl-8-[2-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-methylpropyl]-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 167303708 |
| Molecular Formula | C32H41F |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 4-tert-butyl-8-[2-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-methylpropyl]-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | CC(C)(C)c1c2c(c(CC(C)(C)c3c4c(c(F)c5c3CCC5)CCC4)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C32H41F/c1-31(2,3)28-21-12-6-10-19(21)27(20-11-7-13-22(20)28)18-32(4,5)29-23-14-8-16-25(23)30(33)26-17-9-15-24(26)29/h6-18H2,1-5H3 |
| InChIKey | UBKQAPOMNMACLL-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |