About [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate
[(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate (PubChem CID 167304397) has the molecular formula C5H8F3NO
and a molecular weight of 155.12 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate.
Molecular Properties
| Compound Name | [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate |
| PubChem CID | 167304397 |
| Molecular Formula | C5H8F3NO |
| Molecular Weight | 155.12 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate |
| SMILES | [H]/N=C(\C)O[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO/c1-3(5(6,7)8)10-4(2)9/h3,9H,1-2H3/b9-4+/t3-/m0/s1 |
| InChIKey | YGZDUKHWCKVHBR-SKYAAQEBSA-N |
| XLogP | 1.95 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate?
The IUPAC name of [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate (CID 167304397) is [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate.
What is the SMILES notation for [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate?
The canonical SMILES for [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate is [H]/N=C(\C)O[C@@H](C)C(F)(F)F.
What is the InChIKey of [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate?
The InChIKey is YGZDUKHWCKVHBR-SKYAAQEBSA-N. The full InChI is InChI=1S/C5H8F3NO/c1-3(5(6,7)8)10-4(2)9/h3,9H,1-2H3/b9-4+/t3-/m0/s1.
What are the key properties of [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate?
[(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate has a molecular weight of 155.12 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1,1,1-trifluoropropan-2-yl] ethanimidate is sourced from PubChem (CID 167304397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).