C23H26FN7O2 — CID 167305707
2-[6-[[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol (PubChem CID 167305707) has the molecular formula C23H26FN7O2 and a molecular weight of 451.51 g/mol. Its IUPAC name is 2-[6-[[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol.
| Compound Name | 2-[6-[[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol |
|---|---|
| PubChem CID | 167305707 |
| Molecular Formula | C23H26FN7O2 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[6-[[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol |
| SMILES | COc1cc(-c2ccc(-c3ncc(N(C)[C@H]4C[C@@H]5CCC[C@@H](N5)[C@H]4F)nn3)c(O)c2)cnn1 |
| InChI | InChI=1S/C23H26FN7O2/c1-31(18-10-15-4-3-5-17(27-15)22(18)24)20-12-25-23(30-28-20)16-7-6-13(8-19(16)32)14-9-21(33-2)29-26-11-14/h6-9,11-12,15,17-18,22,27,32H,3-5,10H2,1-2H3/t15-,17+,18-,22+/m0/s1 |
| InChIKey | DMVYJLXAAHHPHV-KANGHSEISA-N |
| XLogP | 2.77 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |