C24H30FN7O2 — CID 167305781
5-(5-fluoro-2-methoxy-1,2-dihydropyrimidin-6-yl)-2-[6-[methyl-[(1R,3S,5S)-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]phenol (PubChem CID 167305781) has the molecular formula C24H30FN7O2 and a molecular weight of 467.55 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxy-1,2-dihydropyrimidin-6-yl)-2-[6-[methyl-[(1R,3S,5S)-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]phenol.
| Compound Name | 5-(5-fluoro-2-methoxy-1,2-dihydropyrimidin-6-yl)-2-[6-[methyl-[(1R,3S,5S)-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]phenol |
|---|---|
| PubChem CID | 167305781 |
| Molecular Formula | C24H30FN7O2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 5-(5-fluoro-2-methoxy-1,2-dihydropyrimidin-6-yl)-2-[6-[methyl-[(1R,3S,5S)-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]phenol |
| SMILES | COC1N=CC(F)=C(c2ccc(-c3ncc(N(C)[C@H]4C[C@@H]5CCC[C@](C)(C4)N5)nn3)c(O)c2)N1 |
| InChI | InChI=1S/C24H30FN7O2/c1-24-8-4-5-15(29-24)10-16(11-24)32(2)20-13-26-22(31-30-20)17-7-6-14(9-19(17)33)21-18(25)12-27-23(28-21)34-3/h6-7,9,12-13,15-16,23,28-29,33H,4-5,8,10-11H2,1-3H3/t15-,16-,23?,24+/m0/s1 |
| InChIKey | JNPPWJWIYXRFHY-GWZGQBEWSA-N |
| XLogP | 2.99 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |