C26H29F2N5O2S3 — CID 167306102
2-[6-[[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.2.1]octanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol (PubChem CID 167306102) has the molecular formula C26H29F2N5O2S3 and a molecular weight of 577.75 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.2.1]octanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol.
| Compound Name | 2-[6-[[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.2.1]octanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 167306102 |
| Molecular Formula | C26H29F2N5O2S3 |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 2-[6-[[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.2.1]octanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol |
| SMILES | CN(c1cnc(-c2ccc(-c3cc(OC(S)(S)S)ncc3F)cc2O)nn1)[C@H]1C[C@]2(C)CC[C@@](C)(C2)[C@H]1F |
| InChI | InChI=1S/C26H29F2N5O2S3/c1-24-6-7-25(2,13-24)22(28)18(10-24)33(3)20-12-30-23(32-31-20)15-5-4-14(8-19(15)34)16-9-21(29-11-17(16)27)35-26(36,37)38/h4-5,8-9,11-12,18,22,34,36-38H,6-7,10,13H2,1-3H3/t18-,22-,24-,25-/m0/s1 |
| InChIKey | GNDPGYFBBWDGNO-DMGDPNCRSA-N |
| XLogP | 5.97 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|