About 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine
2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine (PubChem CID 16730656) has the molecular formula C23H23N3O
and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine.
Molecular Properties
| Compound Name | 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine |
| PubChem CID | 16730656 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine |
| SMILES | Nc1ccnc(N2CCC3(CC2)OC(c2ccccc2)c2ccccc23)c1 |
| InChI | InChI=1S/C23H23N3O/c24-18-10-13-25-21(16-18)26-14-11-23(12-15-26)20-9-5-4-8-19(20)22(27-23)17-6-2-1-3-7-17/h1-10,13,16,22H,11-12,14-15H2,(H2,24,25) |
| InChIKey | NPAADSKMLSZJIV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine?
The IUPAC name of 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine (CID 16730656) is 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine.
What is the SMILES notation for 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine?
The canonical SMILES for 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine is Nc1ccnc(N2CCC3(CC2)OC(c2ccccc2)c2ccccc23)c1.
What is the InChIKey of 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine?
The InChIKey is NPAADSKMLSZJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O/c24-18-10-13-25-21(16-18)26-14-11-23(12-15-26)20-9-5-4-8-19(20)22(27-23)17-6-2-1-3-7-17/h1-10,13,16,22H,11-12,14-15H2,(H2,24,25).
What are the key properties of 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine?
2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine has a molecular weight of 357.46 g/mol, XLogP of 4.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)pyridin-4-amine is sourced from PubChem (CID 16730656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).