About oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate
oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate (PubChem CID 167306966) has the molecular formula C23H34N2O7S
and a molecular weight of 482.60 g/mol. Its IUPAC name is oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate |
| PubChem CID | 167306966 |
| Molecular Formula | C23H34N2O7S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2S(=O)(=O)OCC(C)(C)C(=O)OC1CCOCC1 |
| InChI | InChI=1S/C23H34N2O7S/c1-23(2,22(26)32-18-9-12-30-13-10-18)16-31-33(27,28)25-15-17(8-11-24(3)4)20-14-19(29-5)6-7-21(20)25/h6-7,14-15,18H,8-13,16H2,1-5H3 |
| InChIKey | QJCRLMXGIPPSCZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
The IUPAC name of oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate (CID 167306966) is oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate.
What is the SMILES notation for oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
The canonical SMILES for oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate is COc1ccc2c(c1)c(CCN(C)C)cn2S(=O)(=O)OCC(C)(C)C(=O)OC1CCOCC1.
What is the InChIKey of oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
The InChIKey is QJCRLMXGIPPSCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N2O7S/c1-23(2,22(26)32-18-9-12-30-13-10-18)16-31-33(27,28)25-15-17(8-11-24(3)4)20-14-19(29-5)6-7-21(20)25/h6-7,14-15,18H,8-13,16H2,1-5H3.
What are the key properties of oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate has a molecular weight of 482.60 g/mol, XLogP of 2.61, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 3-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]sulfonyloxy-2,2-dimethylpropanoate is sourced from PubChem (CID 167306966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).