About (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine]
(3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] (PubChem CID 167307642) has the molecular formula C17H22FNO
and a molecular weight of 275.37 g/mol. Its IUPAC name is (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine].
Molecular Properties
| Compound Name | (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] |
| PubChem CID | 167307642 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] |
| SMILES | C=C[C@H]1c2ccc(F)cc2OC12CCN(C(C)C)CC2 |
| InChI | InChI=1S/C17H22FNO/c1-4-15-14-6-5-13(18)11-16(14)20-17(15)7-9-19(10-8-17)12(2)3/h4-6,11-12,15H,1,7-10H2,2-3H3/t15-/m0/s1 |
| InChIKey | SJVJTJFOYYHDOU-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine]?
The IUPAC name of (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] (CID 167307642) is (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine].
What is the SMILES notation for (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine]?
The canonical SMILES for (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] is C=C[C@H]1c2ccc(F)cc2OC12CCN(C(C)C)CC2.
What is the InChIKey of (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine]?
The InChIKey is SJVJTJFOYYHDOU-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H22FNO/c1-4-15-14-6-5-13(18)11-16(14)20-17(15)7-9-19(10-8-17)12(2)3/h4-6,11-12,15H,1,7-10H2,2-3H3/t15-/m0/s1.
What are the key properties of (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine]?
(3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] has a molecular weight of 275.37 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethenyl-6-fluoro-1'-propan-2-ylspiro[3H-1-benzofuran-2,4'-piperidine] is sourced from PubChem (CID 167307642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).