C25H28ClF3N5O5P — CID 167307906
(2R)-1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-[(4-chlorophenoxy)-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]phosphoryl]oxypropan-2-ol (PubChem CID 167307906) has the molecular formula C25H28ClF3N5O5P and a molecular weight of 601.95 g/mol. Its IUPAC name is (2R)-1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-[(4-chlorophenoxy)-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]phosphoryl]oxypropan-2-ol.
| Compound Name | (2R)-1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-[(4-chlorophenoxy)-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]phosphoryl]oxypropan-2-ol |
|---|---|
| PubChem CID | 167307906 |
| Molecular Formula | C25H28ClF3N5O5P |
| Molecular Weight | 601.95 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | (2R)-1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-[(4-chlorophenoxy)-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]phosphoryl]oxypropan-2-ol |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1C[C@](C)(O)OP(=O)(N[C@@H](C)C(F)(F)F)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28ClF3N5O5P/c1-4-37-13-20-32-21-22(18-7-5-6-8-19(18)31-23(21)30)34(20)14-24(3,35)39-40(36,33-15(2)25(27,28)29)38-17-11-9-16(26)10-12-17/h5-12,15,35H,4,13-14H2,1-3H3,(H2,30,31)(H,33,36)/t15-,24+,40?/m0/s1 |
| InChIKey | NOAFYWXBQVCWLM-QIZVBMIPSA-N |
| XLogP | 5.81 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.95 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|