C18H23ClN4O4S — CID 16730797
[5-(4-chlorophenyl)sulfonyl-4-ethyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-6-yl]methyl N,N-dimethylcarbamate (PubChem CID 16730797) has the molecular formula C18H23ClN4O4S and a molecular weight of 426.93 g/mol. Its IUPAC name is [5-(4-chlorophenyl)sulfonyl-4-ethyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-6-yl]methyl N,N-dimethylcarbamate.
| Compound Name | [5-(4-chlorophenyl)sulfonyl-4-ethyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-6-yl]methyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 16730797 |
| Molecular Formula | C18H23ClN4O4S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [5-(4-chlorophenyl)sulfonyl-4-ethyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-6-yl]methyl N,N-dimethylcarbamate |
| SMILES | CCC1c2cn[nH]c2CC(COC(=O)N(C)C)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4O4S/c1-4-17-15-10-20-21-16(15)9-13(11-27-18(24)22(2)3)23(17)28(25,26)14-7-5-12(19)6-8-14/h5-8,10,13,17H,4,9,11H2,1-3H3,(H,20,21) |
| InChIKey | FISUROXFRSUNRP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |