About 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide
4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide (PubChem CID 16730836) has the molecular formula C18H13F2N3O
and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide |
| PubChem CID | 16730836 |
| Molecular Formula | C18H13F2N3O |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(-c3cc(F)cc(F)c3)ccn2)n1 |
| InChI | InChI=1S/C18H13F2N3O/c1-11-3-2-4-17(22-11)23-18(24)16-9-12(5-6-21-16)13-7-14(19)10-15(20)8-13/h2-10H,1H3,(H,22,23,24) |
| InChIKey | CVBWBHLJBLFSFF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide?
The IUPAC name of 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide (CID 16730836) is 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide.
What is the SMILES notation for 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide?
The canonical SMILES for 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide is Cc1cccc(NC(=O)c2cc(-c3cc(F)cc(F)c3)ccn2)n1.
What is the InChIKey of 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide?
The InChIKey is CVBWBHLJBLFSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2N3O/c1-11-3-2-4-17(22-11)23-18(24)16-9-12(5-6-21-16)13-7-14(19)10-15(20)8-13/h2-10H,1H3,(H,22,23,24).
What are the key properties of 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide?
4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide has a molecular weight of 325.32 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenyl)-N-(6-methyl-2-pyridinyl)pyridine-2-carboxamide is sourced from PubChem (CID 16730836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).