C23H19F3N2O2 — CID 16730839
3-(3-phenylphenyl)-3,4-dihydroisoquinolin-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 16730839) has the molecular formula C23H19F3N2O2 and a molecular weight of 412.41 g/mol. Its IUPAC name is 3-(3-phenylphenyl)-3,4-dihydroisoquinolin-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-phenylphenyl)-3,4-dihydroisoquinolin-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 16730839 |
| Molecular Formula | C23H19F3N2O2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-(3-phenylphenyl)-3,4-dihydroisoquinolin-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | NC1=NC(c2cccc(-c3ccccc3)c2)Cc2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H18N2.C2HF3O2/c22-21-19-12-5-4-9-17(19)14-20(23-21)18-11-6-10-16(13-18)15-7-2-1-3-8-15;3-2(4,5)1(6)7/h1-13,20H,14H2,(H2,22,23);(H,6,7) |
| InChIKey | IZGOILZIFQOLCH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |