C10H16N4O2 — CID 167308601
2-(2,6-dioxopiperidin-3-yl)-3-ethenyl-1,1-dimethylguanidine (PubChem CID 167308601) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-3-ethenyl-1,1-dimethylguanidine.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-3-ethenyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 167308601 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-3-ethenyl-1,1-dimethylguanidine |
| SMILES | C=CN/C(=N/C1CCC(=O)NC1=O)N(C)C |
| InChI | InChI=1S/C10H16N4O2/c1-4-11-10(14(2)3)12-7-5-6-8(15)13-9(7)16/h4,7H,1,5-6H2,2-3H3,(H,11,12)(H,13,15,16) |
| InChIKey | SPNSMKNEBROZPG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|