About (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine
(Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine (PubChem CID 167309488) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine.
Molecular Properties
| Compound Name | (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine |
| PubChem CID | 167309488 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine |
| SMILES | CCCC(CC/C=C\C(C)OC)C(C)CCN(C)C |
| InChI | InChI=1S/C17H35NO/c1-7-10-17(15(2)13-14-18(4)5)12-9-8-11-16(3)19-6/h8,11,15-17H,7,9-10,12-14H2,1-6H3/b11-8- |
| InChIKey | DPBUEUDNECIKMS-FLIBITNWSA-N |
| XLogP | 4.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine?
The IUPAC name of (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine (CID 167309488) is (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine.
What is the SMILES notation for (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine?
The canonical SMILES for (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine is CCCC(CC/C=C\C(C)OC)C(C)CCN(C)C.
What is the InChIKey of (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine?
The InChIKey is DPBUEUDNECIKMS-FLIBITNWSA-N. The full InChI is InChI=1S/C17H35NO/c1-7-10-17(15(2)13-14-18(4)5)12-9-8-11-16(3)19-6/h8,11,15-17H,7,9-10,12-14H2,1-6H3/b11-8-.
What are the key properties of (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine?
(Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine has a molecular weight of 269.47 g/mol, XLogP of 4.36, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-9-methoxy-N,N,3-trimethyl-4-propyldec-7-en-1-amine is sourced from PubChem (CID 167309488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).