C27H24F5N3O3 — CID 16730966
1-[1-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-4-(2,3,4,5,6-pentafluorophenyl)piperazin-2-yl]ethanone (PubChem CID 16730966) has the molecular formula C27H24F5N3O3 and a molecular weight of 533.50 g/mol. Its IUPAC name is 1-[1-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-4-(2,3,4,5,6-pentafluorophenyl)piperazin-2-yl]ethanone.
| Compound Name | 1-[1-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-4-(2,3,4,5,6-pentafluorophenyl)piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 16730966 |
| Molecular Formula | C27H24F5N3O3 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 1-[1-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-4-(2,3,4,5,6-pentafluorophenyl)piperazin-2-yl]ethanone |
| SMILES | CC(=O)C1CN(c2c(F)c(F)c(F)c(F)c2F)CCN1CC(O)COc1cccc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C27H24F5N3O3/c1-14(36)19-12-35(27-25(31)23(29)22(28)24(30)26(27)32)10-9-34(19)11-15(37)13-38-20-8-4-7-18-21(20)16-5-2-3-6-17(16)33-18/h2-8,15,19,33,37H,9-13H2,1H3 |
| InChIKey | GYLUDAMILCWRRF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|