C18H14S — CID 167310595
7-phenyl-3,4-dihydrodibenzothiophene (PubChem CID 167310595) has the molecular formula C18H14S and a molecular weight of 262.38 g/mol. Its IUPAC name is 7-phenyl-3,4-dihydrodibenzothiophene.
| Compound Name | 7-phenyl-3,4-dihydrodibenzothiophene |
|---|---|
| PubChem CID | 167310595 |
| Molecular Formula | C18H14S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 7-phenyl-3,4-dihydrodibenzothiophene |
| SMILES | C1=Cc2c(sc3cc(-c4ccccc4)ccc23)CC1 |
| InChI | InChI=1S/C18H14S/c1-2-6-13(7-3-1)14-10-11-16-15-8-4-5-9-17(15)19-18(16)12-14/h1-4,6-8,10-12H,5,9H2 |
| InChIKey | JHPUGLDENBFOBX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |