About (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate
(4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 167311069) has the molecular formula C17H22O5
and a molecular weight of 306.36 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| PubChem CID | 167311069 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | CC1(C(=O)OCc2ccc(C(C)(C)C)cc2)COC(=O)OC1 |
| InChI | InChI=1S/C17H22O5/c1-16(2,3)13-7-5-12(6-8-13)9-20-14(18)17(4)10-21-15(19)22-11-17/h5-8H,9-11H2,1-4H3 |
| InChIKey | KJTRGSCKVIVXNL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The IUPAC name of (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (CID 167311069) is (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
What is the SMILES notation for (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The canonical SMILES for (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate is CC1(C(=O)OCc2ccc(C(C)(C)C)cc2)COC(=O)OC1.
What is the InChIKey of (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The InChIKey is KJTRGSCKVIVXNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O5/c1-16(2,3)13-7-5-12(6-8-13)9-20-14(18)17(4)10-21-15(19)22-11-17/h5-8H,9-11H2,1-4H3.
What are the key properties of (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
(4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate has a molecular weight of 306.36 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)methyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 167311069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).